ChemNet > CAS > 98800-10-3 methylthieno[3,2-b]thiofeen-2-carboxylaat
98800-10-3 methylthieno[3,2-b]thiofeen-2-carboxylaat
Naam product |
methylthieno[3,2-b]thiofeen-2-carboxylaat |
Engelse naam |
methyl thieno[3,2-b]thiophene-2-carboxylate; |
MF |
C8H6O2S2 |
Molecuulgewicht |
198.262 |
InChI |
InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
CAS-nummer |
98800-10-3 |
Moleculaire Structuur |
|
Dichtheid |
1.412g/cm3 |
Smeltpunt |
94℃ |
Kookpunt |
306.1°C at 760 mmHg |
Brekingsindex |
1.673 |
Vlampunt |
138.9°C |
Dampdruk |
0.000788mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|